For research use only. Not for therapeutic Use.
Pyruvic acid-13C3 Sodium Salt(Cat No.:R030831) is a labeled version of pyruvic acid, where all three carbon atoms are enriched with carbon-13 (13C). This isotopic labeling enhances the molecule’s traceability and stability in analytical studies, particularly in mass spectrometry and NMR spectroscopy. Pyruvic acid is a key intermediate in metabolic pathways such as glycolysis and fermentation. The sodium salt form increases its solubility and ease of handling. This labeled compound is essential for studying cellular metabolism and energy production, offering insights into various biochemical processes and aiding in research on metabolic disorders.
CAS Number | 142014-11-7 |
Synonyms | 2-Oxopropanoic Acid13C3 Sodium Salt; Sodium Pyruvate13C3; Sodium α-Ketopropionate13C3 |
Molecular Formula | C3H3NaO3 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Storage | -20°C |
IUPAC Name | sodium;2-oxo(1,2,3-13C3)propanoate |
InChI | InChI=1S/C3H4O3.Na/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1/i1+1,2+1,3+1; |
InChIKey | DAEPDZWVDSPTHF-HCULJTSZSA-M |
SMILES | [13CH3][13C](=O)[13C](=O)[O-].[Na+] |