For research use only. Not for therapeutic Use.
Pyruvic Acid Sodium Salt(CAT: R054309) is a compound of significance in both pharmaceutical and organic chemistry. This chemical is utilized as a key intermediate in various organic reactions, including the synthesis of pharmaceuticals and fine chemicals. Its applications extend to pharmaceutical chemistry, where it plays a role in the production of drugs with therapeutic properties.
CAS Number | 113-24-6 |
Synonyms | 2-Oxopropanoic Acid Sodium Salt; Sodium Pyruvate; Sodium α-Ketopropionate; |
Molecular Formula | C3H3NaO3 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Storage | -20°C |
IUPAC Name | sodium;2-oxopropanoate |
InChI | InChI=1S/C3H4O3.Na/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
InChIKey | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
SMILES | CC(=O)C(=O)[O-].[Na+] |