For research use only. Not for therapeutic Use.
QD232 is an experimental compound studied for its potential therapeutic effects, likely within a specific research context. Detailed information about its structure, mechanism of action, and applications is not widely available in public scientific literature, suggesting it might be part of emerging research, a proprietary compound, or under investigation in preclinical or early clinical studies. Due to its obscurity, QD232’s exact purpose and relevance are primarily known within specialized research communities or proprietary projects.
| Catalog Number | I035306 |
| CAS Number | 1527467-32-8 |
| Synonyms | QD232; QD 232; QD-232; |
| Molecular Formula | C16H11N3O3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 ℃ for short term (days to weeks) or -20 ℃ for long term (months to years). |
| IUPAC Name | 6-((3-acetylphenyl)amino)quinazoline-5,8-dione |
| InChI | InChI=1S/C16H11N3O3/c1-9(20)10-3-2-4-11(5-10)19-13-6-14(21)15-12(16(13)22)7-17-8-18-15/h2-8,19H,1H3 |
| InChIKey | ISLYLVODAYGJNW-UHFFFAOYSA-N |
| SMILES | O=C(C(NC1=CC=CC(C(C)=O)=C1)=C2)C3=CN=CN=C3C2=O |
