For research use only. Not for therapeutic Use.
Quercetin（Cat No.:I000620）is a naturally occurring flavonoid found in many fruits, vegetables, and grains. Known for its potent antioxidant and anti-inflammatory properties, quercetin helps protect cells from oxidative damage and reduces inflammation. It has been studied for its potential health benefits, including improving cardiovascular health, boosting the immune system, and alleviating allergy symptoms. Quercetin also shows promise in cancer prevention and treatment due to its ability to inhibit tumor growth and induce apoptosis in cancer cells. Its broad spectrum of biological activities makes quercetin a valuable compound in nutraceuticals and functional foods.
| Catalog Number | I000620 |
| CAS Number | 117-39-5 |
| Synonyms | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| Molecular Formula | C15H10O7 |
| Purity | ≥95% |
| Target | PI3K |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| InChI | InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
| InChIKey | REFJWTPEDVJJIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
