For research use only. Not for therapeutic Use.
Quinacrine dihydrochloride (Cat No.:A000170) is an antimalarial and anti-inflammatory agent that has seen broad application in treating malaria, giardiasis, and certain autoimmune conditions. It acts by intercalating with DNA and inhibiting key enzymes, which disrupts parasitic cell function and replication. Quinacrine’s anti-inflammatory properties have also made it valuable in lupus treatment, particularly for patients intolerant to other medications. In addition to its therapeutic roles, quinacrine has been investigated in cancer research for its potential in targeting specific tumor pathways, highlighting its versatility and clinical importance in diverse medical fields.
| Catalog Number | A000170 |
| CAS Number | 69-05-6 |
| Synonyms | NA |
| Molecular Formula | C23H30ClN3O.2HCl |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride |
| InChI | InChI=1S/C23H30ClN3O.2ClH/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23;;/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26);2*1H |
| InChIKey | UDKVBVICMUEIKS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=C(C=CC2=NC3=C1C=CC(=C3)Cl)OC.Cl.Cl |
