For research use only. Not for therapeutic Use.
Quinacrine Dihydrochloride Dihydrate(Cat No.:M010474)is a synthetic acridine derivative with diverse applications in medicine and research. Known for its antiprotozoal and antimalarial properties, it inhibits DNA and RNA synthesis, effectively treating Giardia lamblia and Plasmodium infections. In research, Quinacrine is valued for its role in apoptosis studies, where it acts as a lysosomal dye and DNA intercalator. It also exhibits potential in anticancer and prion disease studies due to its ability to modulate cellular processes. This compound is an essential tool in pharmacological and biochemical investigations.
Catalog Number | M010474 |
CAS Number | 6151-30-0 |
Synonyms | QUINACRINE DIHYDROCHLORIDE DIHYDRATE;QUINACRINE HYDROCHLORIDE, DIHYDRATE;6-chloro-9-((4-(diethylamino)-1-methylbutyl)amino)-2-methoxy-acridindihydr;6-chloro-9-((4-(diethylamino)-1-methylbutyl)amino)-2-methoxyacridinedihydroc;atabrinehydrochloridedihy |
Molecular Formula | C23H36Cl3N3O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrate;dihydrochloride |
InChI | InChI=1S/C23H30ClN3O.2ClH.2H2O/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23;;;;/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26);2*1H;2*1H2 |
InChIKey | RZFNKJVCPDLQQA-UHFFFAOYSA-N |
SMILES | CCN(CC)CCCC(C)NC1=C2C=C(C=CC2=NC3=C1C=CC(=C3)Cl)OC.O.O.Cl.Cl |