For research use only. Not for therapeutic Use.
Quinfamide(Cat No.:R013345)is an antiparasitic medication primarily used to treat amoebiasis, specifically targeting Entamoeba histolytica, the causative agent of intestinal infections. It acts directly on the amoebic trophozoites in the gut, inhibiting their ability to adhere to and invade intestinal tissue, leading to their elimination. Quinfamide is known for its high efficacy with minimal side effects, often effective in a single-dose regimen, which enhances patient compliance. Its targeted action and low toxicity make it a valuable treatment option in managing amoebiasis, especially in regions where the infection is endemic.
CAS Number | 62265-68-3 |
Synonyms | 2-Furancarboxylic Acid 1-(2,2-Dichloroacetyl)-1,2,3,4-tetrahydro-6-quinolinyl Ester; 1-(Dichloroacetyl)-6-(2-furoyloxy)-1,2,3,4-tetrahydro-6-quinoline; Amenide; Amenox; Win 40014; |
Molecular Formula | C16H13Cl2NO4 |
Purity | ≥95% |
Target | Parasite |
Storage | Store at RT |
IUPAC Name | [1-(2,2-dichloroacetyl)-3,4-dihydro-2H-quinolin-6-yl] furan-2-carboxylate |
InChI | InChI=1S/C16H13Cl2NO4/c17-14(18)15(20)19-7-1-3-10-9-11(5-6-12(10)19)23-16(21)13-4-2-8-22-13/h2,4-6,8-9,14H,1,3,7H2 |
InChIKey | SBJGFIXQRZOVTO-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CC(=C2)OC(=O)C3=CC=CO3)N(C1)C(=O)C(Cl)Cl |