For research use only. Not for therapeutic Use.
Quinidine hydrochloride monohydrate (Cat.No:I012987) is a medication used to treat certain heart rhythm disorders, particularly those associated with atrial fibrillation and ventricular arrhythmias. It is a class I antiarrhythmic agent that works by blocking specific ion channels in the heart, regulating electrical signals and restoring normal rhythm.
CAS Number | 6151-40-2 |
Molecular Formula | C₂₀H₂₇ClN₂O₃ |
Purity | ≥95% |
Target | Anti-infection |
Solubility | DMSO: 106.7 mg/mL |
IUPAC Name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;hydrate;hydrochloride |
InChI | InChI=1S/C20H24N2O2.ClH.H2O/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1H;1H2/t13-,14-,19+,20-;;/m0../s1 |
InChIKey | SGVZDMWHXVXUBY-KAIFKDDSSA-N |
SMILES | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O.O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |