For research use only. Not for therapeutic Use.
Quinine Hydrochloride Dihydrate(Cat No.:A000470)is an antimalarial medication used to treat uncomplicated and severe malaria caused by Plasmodium species. It works by interfering with the parasite’s ability to digest hemoglobin, leading to its death. Quinine also possesses analgesic and antipyretic properties, making it effective in reducing fever and pain associated with malaria. Additionally, it is used to treat nocturnal leg cramps. Common side effects include tinnitus, nausea, and dizziness. Despite the advent of newer antimalarials, Quinine remains a crucial option in managing drug-resistant malaria and severe cases.
CAS Number | 6119-47-7 |
Synonyms | (8α,9R)-6’-Methoxycinchonan-9-ol Monohydrochloride Dihydrate; Quinine Hydrochloride Dihydrate; |
Molecular Formula | C20H24N2O2.HCl.2H2O |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
Solubility | H2O: soluble; DMSO: 79 mg/mL |
Storage | Room temperature |
IUPAC Name | (R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;dihydrate;hydrochloride |
InChI | InChI=1S/C20H24N2O2.ClH.2H2O/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1H;2*1H2/t13-,14-,19-,20+;;;/m0.../s1 |
InChIKey | MPQKYZPYCSTMEI-FLZPLBAKSA-N |
SMILES | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O.O.O.Cl |