For research use only. Not for therapeutic Use.
Quinizarin (Cat.No:R071109) is a natural dye extracted from the roots of the madder plant. It has been historically used as a red dye for textiles and has applications in traditional medicine. Quinizarin is also employed in analytical chemistry for metal ion detection and exhibits potential in photodynamic therapy research.
| Catalog Number | R071109 |
| CAS Number | 81-64-1 |
| Synonyms | 1.4-Dihydroxy-9.10-anthracene dione, C.I. #58050 |
| Molecular Formula | C14H8O4 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | RT |
| IUPAC Name | 1,4-dihydroxyanthracene-9,10-dione |
| InChI | InChI=1S/C14H8O4/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,15-16H |
| InChIKey | GUEIZVNYDFNHJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)O)O |
