For research use only. Not for therapeutic Use.
Quinocetone(Cat No.:R065770)is a synthetic quinoxaline 1,4-dioxide derivative widely used as a veterinary feed additive to promote growth and prevent bacterial infections in livestock. It exhibits broad-spectrum antimicrobial activity, particularly against Gram-positive and Gram-negative bacteria, by interfering with bacterial DNA synthesis. Quinocetone enhances feed efficiency and animal health, making it valuable in agricultural practices. However, its safety and potential residues in food products have raised concerns, prompting ongoing research into its environmental impact, metabolism, and regulatory compliance to ensure safe usage in the livestock industry.
CAS Number | 81810-66-4 |
Molecular Formula | C18H14N2O3 |
Purity | ≥95% |
Target | Antibiotic |
Storage | -20°C |
IUPAC Name | (E)-1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-3-phenylprop-2-en-1-one |
InChI | InChI=1S/C18H14N2O3/c1-13-18(17(21)12-11-14-7-3-2-4-8-14)20(23)16-10-6-5-9-15(16)19(13)22/h2-12H,1H3/b12-11+ |
InChIKey | IOKWXGMNRWVQHX-VAWYXSNFSA-N |
SMILES | CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(=O)/C=C/C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |