For research use only. Not for therapeutic Use.
Quinoline-3-Carboxylic Acid(Cat No.:M018931)is a versatile organic compound widely used in pharmaceutical and chemical research. With its quinoline backbone, it serves as a key intermediate in the synthesis of various bioactive molecules, including antimalarial agents and other therapeutic compounds. This compound plays an essential role in the development of targeted treatments and the exploration of new drug candidates. Its strong structural properties and functional groups make it a valuable starting material for the design of novel molecular scaffolds. Quinoline-3-Carboxylic Acid is crucial for advancing medicinal chemistry applications.
CAS Number | 118803-81-9 |
Molecular Formula | C22H23FN4O5 |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at -20°C |
IUPAC Name | 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;pyridine-3-carboxylic acid |
InChI | InChI=1S/C16H18FN3O3.C6H5NO2/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20;8-6(9)5-2-1-3-7-4-5/h7-9,18H,2-6H2,1H3,(H,22,23);1-4H,(H,8,9) |
InChIKey | WRIFLTAYLRDENF-UHFFFAOYSA-N |
SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O.C1=CC(=CN=C1)C(=O)O |