For research use only. Not for therapeutic Use.
Quinoline-5-sulfonamide(Cat No.:L007478), is a significant chemical compound in the field of organic synthesis and medicinal chemistry. This molecule consists of a quinoline ring, a heterocyclic structure containing nitrogen, attached to a sulfonamide group. Researchers investigate its versatile reactivity and biological activities, aiming to develop new drugs and bioactive compounds. The unique structural features of quinoline-5-sulfonamide make it valuable for designing molecules with specific pharmaceutical properties.
CAS Number | 415913-05-2 |
Molecular Formula | C9H8N2O2S |
Purity | ≥95% |
IUPAC Name | quinoline-5-sulfonamide |
InChI | InChI=1S/C9H8N2O2S/c10-14(12,13)9-5-1-4-8-7(9)3-2-6-11-8/h1-6H,(H2,10,12,13) |
InChIKey | DWHIGANEUNBVPB-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC=N2)C(=C1)S(=O)(=O)N |