For research use only. Not for therapeutic Use.
Quinolinic Acid-d3 is a high-purity deuterated compound used in advanced pharmaceutical and biochemical research. This isotopically labeled version of Quinolinic Acid is essential for studies involving neurotoxic metabolites, kynurenine pathway, neurodegenerative diseases, pharmacokinetics, and metabolic pathways. Featuring three deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for neuropharmacology research and drug development, Quinolinic Acid-d3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000008 |
| CAS Number | 138946-42-6 |
| Molecular Formula | C7H2D3NO4 |
| Purity | ≥95% |
| Target | Membrane Transporter/Ion Channel |
| IUPAC Name | 4,5,6-trideuteriopyridine-2,3-dicarboxylic acid |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/i1D,2D,3D |
| InChIKey | GJAWHXHKYYXBSV-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])C(=O)O)C(=O)O)[2H] |
