Quinomycin A (Cat.No:M019914) is a natural antibiotic with potent antitumor activity. It functions by binding to DNA and inhibiting RNA synthesis, leading to cell death. Quinomycin A has been studied for its potential in cancer therapy, particularly against leukemia and other solid tumors. Its unique mechanism makes it a valuable research subject.
Catalog Number | M019914 |
CAS Number | 512-64-1 |
Synonyms | echinomycina;nsc526417;ECHINOMYCIN;QUINOMYCIN A;N-[(1R,4S,8R,11S,14R,17S,21R,24S)-3,11,13,16,24,26-hexamethyl-27-methylsulfanyl-2,5,9,12,15,18,22,25-octaoxo-4,17-di(propan-2-yl)-8-(quinoxaline-2-carbonylamino)-6,19-dioxa-28-thia-3,10,13,16,23,26-hexa |
Molecular Formula | C51H64N12O12S2 |
Purity | 95% |
Storage | -20°C |
InChIKey | AUJXLBOHYWTPFV-RQLJINDISA-N |
SMILES | CC1C(=O)N(C2CSC(C(C(=O)N(C(C(=O)OCC(C(=O)N1)NC(=O)C3=NC4=CC=CC=C4N=C3)C(C)C)C)N(C(=O)C(NC(=O)C(COC(=O)C(N(C2=O)C)C(C)C)NC(=O)C5=NC6=CC=CC=C6N=C5)C)C)SC)C |
Reference | 1: Ponnurangam S, Dandawate PR, Dhar A, Tawfik OW, Parab RR, Mishra PD, Ranadive <br> 3: Steinerová N, Lipavská H, Stajner K, Cáslavská J, Blumauerová M, Cudlín J, 4: Sato K, Niinomi Y, Katagiri K, Matsukage A, Minagawa T. Prevention of phage 5: Sato K, Shiratori O, Katagiri K. The mode of action of quinoxaline 6: KATAGIRI K, SHOJI J, YOSHISA T. Identity of levomycin and quinomycin A |