For research use only. Not for therapeutic Use.
Quinoprazine（Cat No.:M023141） is a synthetic heterocyclic compound characterized by its unique chemical structure, which incorporates elements of both quinoline and pyrazine. This compound is primarily explored in pharmaceutical chemistry due to its potential biological activity. Quinoprazines are interesting for their ability to interact with various biological targets, leading to investigations into their use as potential therapeutic agents, especially in treating infections and cancers. The chemical properties of quinoprazine, such as its stability and reactivity, make it a suitable candidate for drug development, providing a foundation for creating new medicinal compounds.
| Catalog Number | M023141 |
| CAS Number | 115618-99-0 |
| Synonyms | quinoprazine |
| Molecular Formula | C25H26N4 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]benzo[g]quinolin-4-amine |
| InChI | InChI=1S/C25H26N4/c1-2-28-13-15-29(16-14-28)22-9-7-21(8-10-22)27-24-11-12-26-25-18-20-6-4-3-5-19(20)17-23(24)25/h3-12,17-18H,2,13-16H2,1H3,(H,26,27) |
| InChIKey | FGVVQTVRBTWGJA-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=CC=C(C=C2)NC3=CC=NC4=CC5=CC=CC=C5C=C34 |
