For research use only. Not for therapeutic Use.
Quinoxidine(Cat No.:M122554) is a chemical compound. It is a heterocyclic compound containing a quinoxaline ring system. Quinoxidine has been studied for its potential pharmacological properties, including its activity as a serotonin receptor antagonist. It has shown promise in preclinical studies for its potential use in the treatment of various psychiatric disorders, such as anxiety and depression. Quinoxidine’s mechanism of action involves the modulation of serotonin neurotransmission, which is involved in mood regulation.
Catalog Number | M122554 |
CAS Number | 10103-89-6 |
Synonyms | Quinoxidine |
Molecular Formula | C14H14N2O6 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | [3-(acetyloxymethyl)-1-oxido-4-oxoquinoxalin-4-ium-2-yl]methyl acetate |
InChI | InChI=1S/C14H14N2O6/c1-9(17)21-7-13-14(8-22-10(2)18)16(20)12-6-4-3-5-11(12)15(13)19/h3-6H,7-8H2,1-2H3 |
InChIKey | UPTLHMUHWUBHKR-UHFFFAOYSA-N |
SMILES | CC(=O)OCC1=C([N+](=O)C2=CC=CC=C2N1[O-])COC(=O)C |