For research use only. Not for therapeutic Use.
| Catalog Number | R000401 |
| CAS Number | 52809-07-1 |
| Synonyms | L-(+)-α-Amino-3,5-dioxo-1,2,4-oxadiazolidine-2-propanoic Acid; L-Quisqualic Acid; (αS)-α-Amino-3,5-dioxo-1,2,4-Oxadiazolidine-2-propanoic Acid |
| Molecular Formula | C5H7N3O5 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in 1eq. NaOH and to 10 mM in sterile water |
| Storage | Store at RT |
| IUPAC Name | (2S)-2-amino-3-(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)propanoic acid |
| InChI | InChI=1S/C5H7N3O5/c6-2(3(9)10)1-8-4(11)7-5(12)13-8/h2H,1,6H2,(H,9,10)(H,7,11,12)/t2-/m0/s1 |
| InChIKey | ASNFTDCKZKHJSW-REOHCLBHSA-N |
| SMILES | C(C(C(=O)O)N)N1C(=O)NC(=O)O1 |
