For research use only. Not for therapeutic Use.
(R)-1-(3-nitrophenyl)ethanamine hydrochloride(Cat No.:L006831), is a chiral organic compound used in pharmaceutical research and development. Its molecular structure comprises an ethanamine backbone with a 3-nitrophenyl group, and it exists in the hydrochloride salt form, enhancing its stability and solubility. This compound serves as a valuable intermediate in the synthesis of various biologically active molecules, particularly in the design and creation of novel drugs.
CAS Number | 1037092-07-1 |
Molecular Formula | C8H11ClN2O2 |
Purity | ≥95% |
IUPAC Name | (1R)-1-(3-nitrophenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C8H10N2O2.ClH/c1-6(9)7-3-2-4-8(5-7)10(11)12;/h2-6H,9H2,1H3;1H/t6-;/m1./s1 |
InChIKey | IKBMZMKEBCIDPD-FYZOBXCZSA-N |
SMILES | CC(C1=CC(=CC=C1)[N+](=O)[O-])N.Cl |