For research use only. Not for therapeutic Use.
(R)-1-(3-(Trifluoromethoxy)phenyl)ethanamine (Cat.No:L003729) is a significant chiral compound with diverse applications in pharmaceutical research. Its enantiopure form, featuring a trifluoromethoxyphenyl group, exhibits unique pharmacological properties. This compound serves as a crucial intermediate in the synthesis of specialized pharmaceutical agents.
CAS Number | 1228559-55-4 |
Molecular Formula | C9H10F3NO |
Purity | ≥95% |
IUPAC Name | (1R)-1-[3-(trifluoromethoxy)phenyl]ethanamine |
InChI | InChI=1S/C9H10F3NO/c1-6(13)7-3-2-4-8(5-7)14-9(10,11)12/h2-6H,13H2,1H3/t6-/m1/s1 |
InChIKey | XRRKIDIISISOKH-ZCFIWIBFSA-N |
SMILES | C[C@H](C1=CC(=CC=C1)OC(F)(F)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |