For research use only. Not for therapeutic Use.
(R)-1-(3,5-dichlorophenyl)ethanamine hydrochloride (Cat.No:L004031) is a significant chiral amine compound in pharmaceutical research. Its unique structure, featuring a dichlorophenyl group, imparts specific reactivity and pharmacological properties. This compound serves as a crucial intermediate in the synthesis of specialized pharmaceutical agents, particularly those with potential therapeutic applications.
Catalog Number | L004031 |
CAS Number | 2411591-66-5 |
Molecular Formula | C8H10Cl3N |
Purity | ≥95% |
IUPAC Name | (1R)-1-(3,5-dichlorophenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C8H9Cl2N.ClH/c1-5(11)6-2-7(9)4-8(10)3-6;/h2-5H,11H2,1H3;1H/t5-;/m1./s1 |
InChIKey | YKPAICVWOBWQTG-NUBCRITNSA-N |
SMILES | C[C@H](C1=CC(=CC(=C1)Cl)Cl)N.Cl |