For research use only. Not for therapeutic Use.
R)-1,2-Propylene Carbonate (CAT: R003480) is a valuable compound in green chemistry, prized for its eco-friendly properties. This solvent offers a safer alternative to traditional, more hazardous solvents due to its low toxicity, low volatility, and biodegradability. Its versatility makes it a preferred choice in various chemical processes, promoting environmentally conscious practices while maintaining effectiveness.
CAS Number | 16606-55-6 |
Synonyms | (R)-(+)-1,2-Propylene Carbonate; (+)-(4R)-4-methyl-1,3-dioxolan-2-one; (+)-Carbonic Acid Cyclic Propylene Ester; |
Molecular Formula | C4H6O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4R)-4-methyl-1,3-dioxolan-2-one |
InChI | InChI=1S/C4H6O3/c1-3-2-6-4(5)7-3/h3H,2H2,1H3/t3-/m1/s1 |
InChIKey | RUOJZAUFBMNUDX-GSVOUGTGSA-N |
SMILES | CC1COC(=O)O1 |