For research use only. Not for therapeutic Use.
(R)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine (CAT: L000234) is a notable compound in medicinal and organic chemistry. This chemical plays a significant role in drug development due to its potential pharmaceutical applications. It acts as a key structural component for the synthesis of pharmaceutical agents. In medicinal chemistry, this compound is utilized for creating specific drug candidates and influencing their biological activity, making it a valuable tool for researchers and chemists in the pharmaceutical field.
CAS Number | 210095-55-9 |
Molecular Formula | C17H19ClN2O |
Purity | ≥95% |
IUPAC Name | 2-[(R)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine |
InChI | InChI=1S/C17H19ClN2O/c18-14-6-4-13(5-7-14)17(16-3-1-2-10-20-16)21-15-8-11-19-12-9-15/h1-7,10,15,17,19H,8-9,11-12H2/t17-/m1/s1 |
InChIKey | OTZYADIPHOGUDN-QGZVFWFLSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |