For research use only. Not for therapeutic Use.
(R)-2-Amino-2-(3-(methylthio)phenyl)ethanol hydrochloride (Cat.No:L003866) is a crucial chiral compound with applications in pharmaceutical research. Its unique structure, featuring an amino alcohol with a methylthio-substituted phenyl group, imparts distinctive reactivity. This compound serves as a key intermediate in the synthesis of specialized molecules, particularly in the development of biologically active agents.
CAS Number | 2442565-24-2 |
Molecular Formula | C9H14ClNOS |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride |
InChI | InChI=1S/C9H13NOS.ClH/c1-12-8-4-2-3-7(5-8)9(10)6-11;/h2-5,9,11H,6,10H2,1H3;1H/t9-;/m0./s1 |
InChIKey | FAKQQESIYANEIA-FVGYRXGTSA-N |
SMILES | CSC1=CC=CC(=C1)[C@H](CO)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |