For research use only. Not for therapeutic Use.
(R)-2-Amino-2-(4-(tert-butyl)phenyl)ethanol hydrochloride (Cat.No:L003779) is a vital chiral compound with diverse applications in pharmaceutical research. Its enantiopure form, characterized by a tert-butylphenyl moiety, exhibits unique pharmacological properties. This compound serves as a crucial building block in the synthesis of biologically active molecules, demonstrating its importance in drug development.
CAS Number | 1391444-61-3 |
Molecular Formula | C12H20ClNO |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-2-(4-tert-butylphenyl)ethanol;hydrochloride |
InChI | InChI=1S/C12H19NO.ClH/c1-12(2,3)10-6-4-9(5-7-10)11(13)8-14;/h4-7,11,14H,8,13H2,1-3H3;1H/t11-;/m0./s1 |
InChIKey | XZLMNRBNEGHVNB-MERQFXBCSA-N |
SMILES | CC(C)(C)C1=CC=C(C=C1)[C@H](CO)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |