For research use only. Not for therapeutic Use.
(R)-2-Amino-2-cyclopropylethanol hydrochloride (Cat.No:L003804) is a vital compound in pharmaceutical research. Its unique cyclopropyl and amino moieties confer distinct reactivity. This compound is employed as a key intermediate in the synthesis of specialized molecules with applications in medicinal chemistry. Its chirality renders it valuable in the creation of enantiopure pharmaceuticals.
CAS Number | 1401163-31-2 |
Molecular Formula | C5H12ClNO |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-2-cyclopropylethanol;hydrochloride |
InChI | InChI=1S/C5H11NO.ClH/c6-5(3-7)4-1-2-4;/h4-5,7H,1-3,6H2;1H/t5-;/m0./s1 |
InChIKey | YPMKFTYTWTWHKM-JEDNCBNOSA-N |
SMILES | C1CC1[C@H](CO)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |