For research use only. Not for therapeutic Use.
(R)-2-Amino-2-(thiophen-3-yl)acetic acid（Cat No.:R025782）is a chiral amino acid derivative featuring a thiophene ring attached to the β-carbon. The (R)-enantiomer is of particular interest due to its potential biological activity, making it a valuable building block for the synthesis of peptides and bioactive compounds. The thiophene ring imparts unique electronic and steric properties to the molecule, which can be leveraged in the development of compounds with specific interactions in pharmaceutical research. This compound is especially useful in the design of molecules targeting neurological or metabolic pathways, as well as for drug discovery studies.
| CAS Number | 1194-86-1 |
| Synonyms | (2R)-2-amino-2-thiophen-3-ylacetic acid |
| Molecular Formula | C6H7NO2S |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-amino-2-thiophen-3-ylacetic acid |
| InChI | InChI=1S/C6H7NO2S/c7-5(6(8)9)4-1-2-10-3-4/h1-3,5H,7H2,(H,8,9)/t5-/m1/s1 |
| InChIKey | BVGBBSAQOQTNGF-RXMQYKEDSA-N |
| SMILES | C1=CSC=C1[C@H](C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
