For research use only. Not for therapeutic Use.
(R)-2-bromo-4-methylpentanoic acid (Cat.No:L003346) is a pivotal chiral compound in organic synthesis. Its specific configuration imparts unique reactivity, making it a crucial building block for the creation of diverse pharmaceuticals and fine chemicals, underscoring its significance in contemporary chemical research.
CAS Number | 42990-28-3 |
Molecular Formula | C6H11BrO2 |
Purity | ≥95% |
IUPAC Name | (2R)-2-bromo-4-methylpentanoic acid |
InChI | InChI=1S/C6H11BrO2/c1-4(2)3-5(7)6(8)9/h4-5H,3H2,1-2H3,(H,8,9)/t5-/m1/s1 |
InChIKey | NNFDHJQLIFECSR-RXMQYKEDSA-N |
SMILES | CC(C)C[C@H](C(=O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |