For research use only. Not for therapeutic Use.
(R)-(2-Chlorophenyl)oxirane is an organic compound characterized by an oxirane ring and a chlorophenyl substituent. As a chiral molecule, it possesses significant importance in synthetic organic chemistry, particularly in the synthesis of pharmaceuticals and agrochemicals. The oxirane group contributes to its reactivity, allowing it to participate in ring-opening reactions and form diverse derivatives. Researchers explore its applications in creating biologically active compounds, highlighting its potential in drug development and its utility as a building block for more complex molecular structures.
CAS Number | 62566-66-9 |
Synonyms | (2R)-(2-Chlorophenyl)-oxirane; (R)-(2-chlorophenyl)-oxirane; (R)-2-Chlorostyrene Oxide |
Molecular Formula | C8H7ClO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R)-2-(2-chlorophenyl)oxirane |
InChI | InChI=1S/C8H7ClO/c9-7-4-2-1-3-6(7)8-5-10-8/h1-4,8H,5H2/t8-/m0/s1 |
InChIKey | RTPJBMWUVSTBPC-QMMMGPOBSA-N |
SMILES | C1C(O1)C2=CC=CC=C2Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |