For research use only. Not for therapeutic Use.
(R)-2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid（Cat No.:R073565）is a chiral amino acid derivative with a unique structure featuring a triple bond at the γ-position and a tert-butoxycarbonyl (Boc) protective group on the amino group. The Boc group is commonly used in peptide synthesis to protect the amine during the process. The compound’s alkyne functionality (–C≡C–) allows for further chemical modifications, including click chemistry reactions. This molecule is useful in peptide and bioactive molecule synthesis and can serve as a building block for creating compounds with potential therapeutic applications in drug discovery.
| CAS Number | 63039-46-3 |
| Synonyms | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoic acid |
| Molecular Formula | C10H15NO4 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoic acid |
| InChI | InChI=1S/C10H15NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h1,7H,6H2,2-4H3,(H,11,14)(H,12,13)/t7-/m1/s1 |
| InChIKey | AMKHAJIFPHJYMH-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC#C)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
