For research use only. Not for therapeutic Use.
(R)-(-)-2,2-Dimethyl-1,3-dioxolane-4-methanol is a chiral building block used in organic synthesis and pharmaceutical research. Known for its application in the synthesis of complex molecules, it is essential for studying stereoselective reactions and developing enantiomerically pure pharmaceuticals. This compound aids in understanding reaction mechanisms and optimizing synthetic methodologies. Researchers rely on (R)-(-)-2,2-Dimethyl-1,3-dioxolane-4-methanol for precise and reliable results in advanced synthetic chemistry and drug development, contributing significantly to innovations in therapeutic agents and chemical synthesis.
CAS Number | 14347-78-5 |
Synonyms | (R)-(-)-1,2-O-Isopropylideneglycerol; (R)-2,2-Dimethyl-[1,3]-dioxolan-4-yl)-methanol; (R)-Solketal; (R)-(-)-Solketal |
Molecular Formula | C6H12O3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
InChI | InChI=1S/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3/t5-/m1/s1 |
InChIKey | RNVYQYLELCKWAN-RXMQYKEDSA-N |
SMILES | CC1(OCC(O1)CO)C |