Home
>
Chemical Reagents>Chiral Reagents> (R)-2,2,2-Trifluoro-1-(3-(trifluoromethyl)phenyl)ethanamine hydrochloride
For research use only. Not for therapeutic Use.
(R)-2,2,2-Trifluoro-1-(3-(trifluoromethyl)phenyl)ethanamine hydrochloride (Cat.No:L003485) is a crucial chiral compound with diverse applications in pharmaceutical research. Its enantiopure form exhibits significant pharmacological activity, making it a valuable building block in drug synthesis. This compound’s trifluoromethylphenyl motif imparts unique reactivity, rendering it pivotal in the development of specialized pharmaceuticals.
CAS Number | 1391469-75-2 |
Molecular Formula | C9H8ClF6N |
Purity | ≥95% |
IUPAC Name | (1R)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
InChI | InChI=1S/C9H7F6N.ClH/c10-8(11,12)6-3-1-2-5(4-6)7(16)9(13,14)15;/h1-4,7H,16H2;1H/t7-;/m1./s1 |
InChIKey | XFJJZYCPEXYDHF-OGFXRTJISA-N |
SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@H](C(F)(F)F)N.Cl |