For research use only. Not for therapeutic Use.
(R)-3-(1-aminoethyl)-5-(trifluoromethyl)aniline (Cat.No:L003953) is a crucial chiral compound in pharmaceutical research. Its unique structure, combining an aminoethyl and trifluoromethyl group, imparts distinctive pharmacological properties. This compound is utilized as a key intermediate in the synthesis of specialized pharmaceuticals, particularly in the development of novel therapeutic agents.
CAS Number | 1213552-98-7 |
Molecular Formula | C9H11F3N2 |
Purity | ≥95% |
IUPAC Name | 3-[(1R)-1-aminoethyl]-5-(trifluoromethyl)aniline |
InChI | InChI=1S/C9H11F3N2/c1-5(13)6-2-7(9(10,11)12)4-8(14)3-6/h2-5H,13-14H2,1H3/t5-/m1/s1 |
InChIKey | SPYLLSKIPZGXNM-RXMQYKEDSA-N |
SMILES | CC(C1=CC(=CC(=C1)N)C(F)(F)F)N |