Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
(R)-3-benzyl-N,N',N'-trimethylpiperidine-3-carbohydrazide dihydrochloride
For research use only, not for therapeutic use.
(R)-3-benzyl-N,N’,N’-trimethylpiperidine-3-carbohydrazide dihydrochloride(CAT: L000004) is a notable compound with pivotal applications in pharmaceutical and organic chemistry. In the pharmaceutical field, it serves as a key building block for the synthesis of bioactive compounds, impacting specific biological targets. Its action method involves its incorporation into drug molecules, contributing to the development of novel medications. In organic chemistry, this compound is an essential intermediate in the creation of various organic compounds, allowing for the diversification of chemical synthesis.
Catalog Number | L000004 |
CAS Number | 883572-50-7 |
Molecular Formula | C16H27Cl2N3O |
Purity | ≥95% |
IUPAC Name | (3R)-3-benzyl-N,N',N'-trimethylpiperidine-3-carbohydrazide;dihydrochloride |
InChI | InChI=1S/C16H25N3O.2ClH/c1-18(2)19(3)15(20)16(10-7-11-17-13-16)12-14-8-5-4-6-9-14;;/h4-6,8-9,17H,7,10-13H2,1-3H3;2*1H/t16-;;/m1../s1 |
InChIKey | KPCPOCCEBGEMKU-GGMCWBHBSA-N |