For research use only. Not for therapeutic Use.
(R)-3-Hydroxydecanoic Acid Methyl Ester is a chiral molecule that is the methyl ester derivative of (R)-3-hydroxydecanoic acid. It features a hydroxyl group at the 3-position on a 10-carbon fatty acid chain, with a methyl ester group at the carboxyl end. This compound is often used in the synthesis of more complex molecules in pharmaceuticals, agrochemicals, and materials science. The (R)-configuration indicates its specific stereochemistry, which can be crucial in biological interactions, making it important for enantioselective synthesis and the development of chiral drugs and other bioactive compounds.
CAS Number | 56618-58-7 |
Synonyms | Methyl (R)-3-Hydroxydecanoate; (R)-3-Hydroxy-decanoic Acid Methyl Ester; |
Molecular Formula | C11H22O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | methyl (3R)-3-hydroxydecanoate |
InChI | InChI=1S/C11H22O3/c1-3-4-5-6-7-8-10(12)9-11(13)14-2/h10,12H,3-9H2,1-2H3/t10-/m1/s1 |
InChIKey | UBVACUZVNTVHTE-SNVBAGLBSA-N |
SMILES | CCCCCCCC(CC(=O)OC)O |