For research use only. Not for therapeutic Use.
(R)-4-(1-Aminoethyl)-3-chlorobenzonitrile (Cat.No:L004048) is a pivotal compound in pharmaceutical research. Its chiral nature and unique structure, featuring an aminoethyl and chlorobenzonitrile group, offer promising pharmacological potential. This compound serves as a crucial intermediate in the synthesis of specialized pharmaceutical agents.
Catalog Number | L004048 |
CAS Number | 1335986-46-3 |
Molecular Formula | C9H9ClN2 |
Purity | ≥95% |
IUPAC Name | 4-[(1R)-1-aminoethyl]-3-chlorobenzonitrile |
InChI | InChI=1S/C9H9ClN2/c1-6(12)8-3-2-7(5-11)4-9(8)10/h2-4,6H,12H2,1H3/t6-/m1/s1 |
InChIKey | HZZCAIWCBDRYHA-ZCFIWIBFSA-N |
SMILES | C[C@H](C1=C(C=C(C=C1)C#N)Cl)N |