For research use only. Not for therapeutic Use.
(R)-4-hydroxymandelic acid(Cat No.:L006768), is an optically active organic compound. It is the enantiomer of 4-hydroxymandelic acid, occurring naturally in certain plants. This compound is used in pharmaceutical research as a chiral building block in the synthesis of various drugs, particularly in the development of beta-adrenergic receptor agonists and antagonists. Its specific stereochemistry is crucial in drug design, ensuring specific interactions with biological targets. Researchers utilize it as a valuable tool in medicinal chemistry, contributing to the creation of new pharmaceutical agents and advancements in the field of asymmetric synthesis.
CAS Number | 13244-78-5 |
Molecular Formula | C8H8O4 |
Purity | ≥95% |
IUPAC Name | (2R)-2-hydroxy-2-(4-hydroxyphenyl)acetic acid |
InChI | InChI=1S/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12)/t7-/m1/s1 |
InChIKey | YHXHKYRQLYQUIH-SSDOTTSWSA-N |
SMILES | C1=CC(=CC=C1C(C(=O)O)O)O |