For research use only. Not for therapeutic Use.
(R)-4-(Hydroxymethyl)pyrrolidin-2-one(Cat No.:L007654), is a chiral chemical compound featuring a pyrrolidin-2-one ring with a hydroxymethyl group attached to the 4-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a key intermediate or a chiral building block in the creation of various organic molecules, especially in the development of pharmaceuticals and fine chemicals. Its chiral nature is valuable in asymmetric synthesis, enabling the production of enantiopure compounds.
CAS Number | 1165450-70-3 |
Molecular Formula | C5H9NO2 |
Purity | ≥95% |
IUPAC Name | (4R)-4-(hydroxymethyl)pyrrolidin-2-one |
InChI | InChI=1S/C5H9NO2/c7-3-4-1-5(8)6-2-4/h4,7H,1-3H2,(H,6,8)/t4-/m1/s1 |
InChIKey | KTOFYLXSANIPND-SCSAIBSYSA-N |
SMILES | C1C(CNC1=O)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |