Home
>
Catalysts and Ligands>Chiral nitrogen ligands> (R)-4-Isopropyl-2-(isoquinolin-1-yl)-4,5-dihydrooxazole
For research use only. Not for therapeutic Use.
(R)-4-Isopropyl-2-(isoquinolin-1-yl)-4,5-dihydrooxazole (Cat.No:L003350) is a pivotal compound in medicinal chemistry. Its unique structure and biological activity make it a promising candidate for the development of novel drugs, highlighting its importance in modern pharmaceutical research.
Catalog Number | L003350 |
CAS Number | 280755-83-1 |
Molecular Formula | C15H16N2O |
Purity | ≥95% |
IUPAC Name | (4R)-2-isoquinolin-1-yl-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C15H16N2O/c1-10(2)13-9-18-15(17-13)14-12-6-4-3-5-11(12)7-8-16-14/h3-8,10,13H,9H2,1-2H3/t13-/m0/s1 |
InChIKey | OMIXBHKYBIDFKX-ZDUSSCGKSA-N |
SMILES | CC(C)[C@@H]1COC(=N1)C2=NC=CC3=CC=CC=C32 |