Home
>
Chemical Reagents>Chiral Reagents> (R)-5-amino-5,6,7,8-tetrahydronaphthalene-2-carbonitrile hydrochloride
For research use only. Not for therapeutic Use.
(R)-5-amino-5,6,7,8-tetrahydronaphthalene-2-carbonitrile hydrochloride (CAT: L000191) is a chemical compound with applications in organic chemistry and potentially in pharmaceutical research. Its action mechanism involves its role as a key intermediate for various chemical reactions, making it a valuable building block for the synthesis of complex organic molecules. In pharmaceutical research, this compound may serve as a crucial intermediate for designing and synthesizing potential drugs, owing to its unique structure and chiral properties.
CAS Number | 2208138-72-9 |
Molecular Formula | C11H13ClN2 |
Purity | ≥95% |
IUPAC Name | (5R)-5-amino-5,6,7,8-tetrahydronaphthalene-2-carbonitrile;hydrochloride |
InChI | InChI=1S/C11H12N2.ClH/c12-7-8-4-5-10-9(6-8)2-1-3-11(10)13;/h4-6,11H,1-3,13H2;1H/t11-;/m1./s1 |
InChIKey | DTVGTFOEOYKYJO-RFVHGSKJSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |