Home
>
Chemical Reagents>Organic Building Blocks> (R)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride
For research use only. Not for therapeutic Use.
(R)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride (Cat.No:L004066) is a significant chiral compound in pharmaceutical research. Its unique structure and stereochemistry make it a crucial intermediate for the synthesis of bioactive molecules. This compound’s specific reactivity offers valuable opportunities for developing novel pharmaceutical agents, highlighting its importance in the field of medicinal chemistry.
CAS Number | 2241594-26-1 |
Molecular Formula | C10H13BrClN |
Purity | ≥95% |
IUPAC Name | (1R)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
InChI | InChI=1S/C10H12BrN.ClH/c11-8-4-5-9-7(6-8)2-1-3-10(9)12;/h4-6,10H,1-3,12H2;1H/t10-;/m1./s1 |
InChIKey | FPTQDDKJLYZDHS-HNCPQSOCSA-N |
SMILES | C1C[C@H](C2=C(C1)C=C(C=C2)Br)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |