Home
>
Chemical Reagents>Chiral Reagents> (R)-6,7-Dihydro-5H-cyclopenta[b]pyridin-7-amine hydrochloride
For research use only. Not for therapeutic Use.
(R)-6,7-Dihydro-5H-cyclopenta[b]pyridin-7-amine hydrochloride (Cat.No:L003772) is a pivotal compound in pharmaceutical research. Its unique cyclopentane-fused pyridine structure imparts distinctive biological activity. This compound holds promise for the development of novel therapeutic agents, particularly in the field of central nervous system disorders. Its enantiopure form showcases its importance in chiral drug synthesis, underscoring its significance in contemporary medicinal chemistry and drug discovery efforts.
CAS Number | 2442565-23-1 |
Molecular Formula | C8H11ClN2 |
Purity | ≥95% |
IUPAC Name | (7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;hydrochloride |
InChI | InChI=1S/C8H10N2.ClH/c9-7-4-3-6-2-1-5-10-8(6)7;/h1-2,5,7H,3-4,9H2;1H/t7-;/m1./s1 |
InChIKey | ZJMHTKKYRWAVTH-OGFXRTJISA-N |
SMILES | C1CC2=C([C@@H]1N)N=CC=C2.Cl |