For research use only. Not for therapeutic Use.
(R)-6,8-Dimercaptooctanoic acid (CAT: M027317) is a chemical compound known for its chelating properties, particularly in binding to heavy metals such as mercury and lead. This compound belongs to a class of molecules called chelating agents, which can form stable complexes with metal ions. These complexes are often used in the treatment of heavy metal poisoning as they facilitate the excretion of toxic metals from the body.
CAS Number | 119365-69-4 |
Molecular Formula | C8H16O2S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (6R)-6,8-bis(sulfanyl)octanoic acid |
InChI | InChI=1S/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10)/t7-/m1/s1 |
InChIKey | IZFHEQBZOYJLPK-SSDOTTSWSA-N |
SMILES | C(CCC(=O)O)CC(CCS)S |