For research use only. Not for therapeutic Use.
Besifloxacin(Cat No.:M134221)is a chlorofluoroquinolone antibiotic, characterized by a dihydroquinoline core with a cyclopropyl group at N and a chlorine atom at C-8. It targets bacterial gyrase and topoisomerase IV, essential enzymes involved in DNA synthesis, effectively inhibiting bacterial DNA replication. This mechanism of action allows moxifloxacin to exert bactericidal effects against both Gram-negative and Gram-positive bacteria, making it valuable in treating various ocular infections, including conjunctivitis and corneal ulcers. Its broad-spectrum activity and effectiveness against resistant strains make pefloxacin a significant option in ophthalmic antibiotic therapy.
CAS Number | 141388-76-3 |
Molecular Formula | C19H21ClFN3O3 |
Purity | ≥95% |
Target | Antibiotic |
Storage | -20°C |
IUPAC Name | 7-[(3R)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
InChI | InChI=1S/C19H21ClFN3O3/c20-15-16-12(18(25)13(19(26)27)9-24(16)11-4-5-11)7-14(21)17(15)23-6-2-1-3-10(22)8-23/h7,9-11H,1-6,8,22H2,(H,26,27)/t10-/m1/s1 |
InChIKey | QFFGVLORLPOAEC-SNVBAGLBSA-N |
SMILES | C1CCN(C[C@@H](C1)N)C2=C(C=C3C(=C2Cl)N(C=C(C3=O)C(=O)O)C4CC4)F |