For research use only. Not for therapeutic Use.
R-7050（Cat No.: I011194）, serves as a cell-permeable antagonist for the tumor necrosis factor-alpha (TNF-α) receptor. It exhibits remarkable selectivity, being 2.3 times more inclined towards inhibiting TNF-α-mediated signaling when compared to interleukin-1 beta (IL-1β)-driven signaling pathways. This selective attribute makes R-7050 a promising candidate for therapeutic interventions aimed at modulating TNF-α-related responses while sparing IL-1β-related processes. Such specificity can be advantageous in targeting specific inflammatory or immune-related conditions where TNF-α plays a crucial role, potentially leading to more precise and effective treatments.
| Catalog Number | I011194 |
| CAS Number | 303997-35-5 |
| Synonyms | 8-Chloro-4-(phenylthio)-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxaline |
| Molecular Formula | C16H8ClF3N4S |
| Purity | ≥95% |
| Target | TNF-α |
| Solubility | Soluble to 20 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 8-chloro-4-phenylsulfanyl-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxaline |
| InChI | InChI=1S/C16H8ClF3N4S/c17-9-6-7-11-12(8-9)24-13(22-23-15(24)16(18,19)20)14(21-11)25-10-4-2-1-3-5-10/h1-8H |
| InChIKey | SUUMKHOVGVYGOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=NC3=C(C=C(C=C3)Cl)N4C2=NN=C4C(F)(F)F |
