For research use only. Not for therapeutic Use.
(R)-Asundexian（Cat No.:I042656）is an investigational oral anticoagulant designed to selectively inhibit Factor XIa, a key enzyme in the blood coagulation cascade. By targeting Factor XIa, (R)-Asundexian aims to prevent thrombus formation while minimizing the risk of bleeding, offering a potential advantage over traditional anticoagulants. It is being evaluated for its ability to reduce the risk of stroke, venous thromboembolism, and other clotting-related conditions without the increased bleeding risks commonly associated with current treatments. (R)-Asundexian is currently undergoing clinical trials to assess its safety, efficacy, and overall potential in thromboembolic disease management.
| CAS Number | 2064124-85-0 |
| Synonyms | 4-[[(2R)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide |
| Molecular Formula | C26H21ClF4N6O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[[(2R)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide |
| InChI | InChI=1S/C26H21ClF4N6O4/c1-3-19(25(40)33-14-5-6-15(24(32)39)18(28)9-14)36-11-21(41-2)17(10-23(36)38)16-8-13(27)4-7-20(16)37-12-22(34-35-37)26(29,30)31/h4-12,19H,3H2,1-2H3,(H2,32,39)(H,33,40)/t19-/m1/s1 Create Date: 2022-12-07 |
| InChIKey | XYWIPYBIIRTJMM-LJQANCHMSA-N |
| SMILES | CC[C@H](C(=O)NC1=CC(=C(C=C1)C(=O)N)F)N2C=C(C(=CC2=O)C3=C(C=CC(=C3)Cl)N4C=C(N=N4)C(F)(F)F)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
