For research use only. Not for therapeutic Use.
(R)-(-)-Benzyl glycidyl ether(Cat No.:M062169), is a chemical compound that contains a chiral benzyl group and a glycidyl ether functional group. It is used as a versatile building block in organic synthesis, particularly in the creation of various chiral compounds and fine chemicals. The chiral nature of this compound allows it to be employed in asymmetric synthesis, where selectivity in chemical reactions is crucial to obtaining specific enantiomers. This makes it valuable in the pharmaceutical and agrochemical industries for the production of chiral intermediates and active pharmaceutical ingredients (APIs). It plays a pivotal role in the development of optically active compounds.
CAS Number | 14618-80-5 |
Molecular Formula | C10H12O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (2R)-2-(phenylmethoxymethyl)oxirane |
InChI | InChI=1S/C10H12O2/c1-2-4-9(5-3-1)6-11-7-10-8-12-10/h1-5,10H,6-8H2/t10-/m0/s1 |
InChIKey | QNYBOILAKBSWFG-JTQLQIEISA-N |
SMILES | C1C(O1)COCC2=CC=CC=C2 |