For research use only. Not for therapeutic Use.
(R)-Elsubrutinib ((R)-ABBV-105) is a Btk inhibitor. (R)-Elsubrutinib can be used in studies of immune diseases (such as rheumatoid arthritis, psoriasis, ankylosing spondylitis, asthma, systemic lupus erythematosus) and cancer[1].
| Catalog Number | I042677 |
| CAS Number | 1643570-23-3 |
| Synonyms | 4-[(3R)-1-prop-2-enoylpiperidin-3-yl]-1H-indole-7-carboxamide |
| Molecular Formula | C17H19N3O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H19N3O2/c1-2-15(21)20-9-3-4-11(10-20)12-5-6-14(17(18)22)16-13(12)7-8-19-16/h2,5-8,11,19H,1,3-4,9-10H2,(H2,18,22)/t11-/m0/s1 |
| InChIKey | UNHZLHSLZZWMNP-NSHDSACASA-N |
| SMILES | C=CC(=O)N1CCCC(C1)C2=C3C=CNC3=C(C=C2)C(=O)N |
| Reference | [1]. Dominique Bonafoux, et al. Primary carboxamides as Btk inhibitors. Patent WO2014210255Al. |
