For research use only. Not for therapeutic Use.
(R)-Elsubrutinib(Cat No.:I042677)is a selective inhibitor of Bruton’s tyrosine kinase (BTK), an enzyme involved in B-cell receptor signaling, which plays a crucial role in the development of certain cancers and autoimmune diseases. By targeting and inhibiting BTK, (R)-Elsubrutinib aims to suppress the activation of B-cells, thereby reducing the proliferation of malignant B-cells and modulating immune responses. It has shown promise in the treatment of hematological malignancies such as B-cell lymphomas, chronic lymphocytic leukemia, and autoimmune disorders. (R)-Elsubrutinib is currently undergoing clinical trials to assess its safety and therapeutic efficacy.
CAS Number | 1643570-23-3 |
Synonyms | 4-[(3R)-1-prop-2-enoylpiperidin-3-yl]-1H-indole-7-carboxamide |
Molecular Formula | C17H19N3O2 |
Purity | ≥95% |
IUPAC Name | 4-[(3R)-1-prop-2-enoylpiperidin-3-yl]-1H-indole-7-carboxamide |
InChI | InChI=1S/C17H19N3O2/c1-2-15(21)20-9-3-4-11(10-20)12-5-6-14(17(18)22)16-13(12)7-8-19-16/h2,5-8,11,19H,1,3-4,9-10H2,(H2,18,22)/t11-/m0/s1 |
InChIKey | UNHZLHSLZZWMNP-NSHDSACASA-N |
SMILES | C=CC(=O)N1CCC[C@@H](C1)C2=C3C=CNC3=C(C=C2)C(=O)N |