For research use only. Not for therapeutic Use.
(R)-Ethyl 2-((tert-butoxycarbonyl)amino)-3-hydroxypropanoate(Cat No.:I043027)is a chiral amino acid derivative used in peptide synthesis and organic chemistry. It features a tert-butoxycarbonyl (Boc) protective group on the amino group, which is commonly used to protect the amine during peptide assembly. The compound includes a hydroxyl group at the β-position, adding reactivity for further functionalization or incorporation into more complex molecules. The ethyl ester group at the α-position facilitates its use in synthetic processes. This molecule has potential applications in drug design, particularly for peptides and bioactive compounds targeting various biological pathways.
CAS Number | 1146954-88-2 |
Synonyms | ethyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
Molecular Formula | C10H19NO5 |
Purity | ≥95% |
IUPAC Name | ethyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
InChI | InChI=1S/C10H19NO5/c1-5-15-8(13)7(6-12)11-9(14)16-10(2,3)4/h7,12H,5-6H2,1-4H3,(H,11,14)/t7-/m1/s1 |
InChIKey | YNMDDOYAIULGRO-SSDOTTSWSA-N |
SMILES | CCOC(=O)[C@@H](CO)NC(=O)OC(C)(C)C |