For research use only. Not for therapeutic Use.
(R)-(-)-Falcarinol (Cat No.: R043227) is a naturally occurring polyacetylene compound found in various plants, particularly in carrots and other Apiaceae species. It has been studied for its potential health benefits, including anti-inflammatory, antioxidant, and anticancer properties. Research suggests it may play a role in preventing cancer by inhibiting the growth of cancer cells and inducing apoptosis. Additionally, (R)-(-)-Falcarinol is believed to contribute to the health benefits of consuming certain vegetables due to its bioactive properties.
CAS Number | 21852-80-2 |
Synonyms | (3R,9Z)-1,9-Heptadecadiene-4,6-diyn-3-ol; ?(Z)-(-)-1,9-Heptadecadiene-4,6-diyn-3-ol; [R-(Z)]-1,9-Heptadecadiene-4,6-diyn-3-ol; Panaxynol; (-)-Falcarinol; (-)-Panaxynol; (cis)-(-)-3-Hydroxy-1,9-heptadecadien-4,6-diyne; Carotatoxin; Falcarinol |
Molecular Formula | C17H24O |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | (3R,9Z)-heptadeca-1,9-dien-4,6-diyn-3-ol |
InChI | 1S/C17H24O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(18)4-2/h4,10-11,17-18H,2-3,5-9,12H2,1H3/b11-10-/t17-/m1/s1 |
InChIKey | UGJAEDFOKNAMQD-QXPKXGMISA-N |
SMILES | CCCCCCC/C=C\CC#CC#C[C@@H](C=C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |